| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:51 UTC |
|---|
| Update Date | 2025-03-21 18:02:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040564 |
|---|
| Frequency | 85.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10O8S |
|---|
| Molecular Mass | 326.0096 |
|---|
| SMILES | O=C(c1ccc(OS(=O)(=O)O)cc1)c1c(O)cc(O)cc1O |
|---|
| InChI Key | YBHGKOIHGKTKSQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl ketonesaryl-phenylketonesbenzoyl derivativesdiphenylmethaneshydrocarbon derivativesorganic oxidesorganooxygen compoundsphenoxy compoundsphenylsulfatesphloroglucinols and derivativessulfuric acid monoestersvinylogous acids |
|---|
| Substituents | diphenylmethanesulfuric acid monoesterbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzophenoneketonephloroglucinol derivativephenylsulfateorganic oxidearylsulfateorganic sulfuric acid or derivativesbenzenetriolaryl-phenylketone1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundsulfate-esterphenolhydrocarbon derivativephenoxy compoundsulfuric acid esterorganooxygen compoundaryl ketone |
|---|
