| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:54 UTC |
|---|
| Update Date | 2025-03-21 18:02:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040676 |
|---|
| Frequency | 84.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12O7S |
|---|
| Molecular Mass | 264.0304 |
|---|
| SMILES | O=S(=O)(O)Oc1cc(CC(O)CO)ccc1O |
|---|
| InChI Key | ZIMGPWCGFMKNCA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoidshydrocarbon derivativesorganic oxidesphenoxy compoundsprimary alcoholssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholmonocyclic benzene moietysulfuric acid monoester1-hydroxy-2-unsubstituted benzenoidaromatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundsecondary alcoholsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterprimary alcoholorganooxygen compound1,2-diol |
|---|