| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:56 UTC |
|---|
| Update Date | 2025-03-21 18:02:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040738 |
|---|
| Frequency | 84.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H4Cl2O4S |
|---|
| Molecular Mass | 241.9207 |
|---|
| SMILES | O=S(=O)(O)Oc1cc(Cl)cc(Cl)c1 |
|---|
| InChI Key | BEKFVULCGSRKNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesdichlorobenzeneshydrocarbon derivativesorganic oxidesorganochloridesorganooxygen compoundsphenoxy compoundssulfuric acid monoesters |
|---|
| Substituents | aryl chloridechlorobenzenemonocyclic benzene moietysulfuric acid monoesterorganochlorideorganohalogen compoundaryl halide1,3-dichlorobenzenearomatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidhalobenzenephenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
