| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:57 UTC |
|---|
| Update Date | 2025-03-21 18:02:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040802 |
|---|
| Frequency | 84.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12O5 |
|---|
| Molecular Mass | 188.0685 |
|---|
| SMILES | CC(=O)C1(O)CC(=O)C(O)C(O)C1 |
|---|
| InChI Key | QJUYGYZNKTZBDL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclitols and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclic ketoneshydrocarbon derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | carbonyl groupcyclitol or derivativescyclic ketoneketonetertiary alcoholorganic oxidesecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivative |
|---|
