| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:57 UTC |
|---|
| Update Date | 2025-03-21 18:02:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040810 |
|---|
| Frequency | 84.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C33H41NO5 |
|---|
| Molecular Mass | 531.2985 |
|---|
| SMILES | COc1ccc(C(O)(c2ccccc2)C2CCN(CCCC(O)c3ccc(C(C)(C)C(=O)O)cc3)CC2)cc1 |
|---|
| InChI Key | ZYGLMHIIJCAONT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acidsanisolesaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenoxy compoundsphenylbutylaminesphenylpropanespiperidinessecondary alcoholstertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholdiphenylmethanephenol ethercarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidalkyl aryl ethercarboxylic acid derivativephenylpropaneorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic aminemethoxybenzenetertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
