| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:50:58 UTC |
|---|
| Update Date | 2025-03-21 18:02:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040844 |
|---|
| Frequency | 84.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O6 |
|---|
| Molecular Mass | 290.079 |
|---|
| SMILES | Oc1cc(O)c2c(c1)OCC(c1ccc(O)c(O)c1)C2O |
|---|
| InChI Key | GAWMNBDCZOTQOT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavans |
|---|
| Direct Parent | isoflavanols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyetherbenzopyran1-benzopyranisoflavanol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholchromanephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|