| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:02 UTC |
|---|
| Update Date | 2025-03-21 18:02:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00040984 |
|---|
| Frequency | 84.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12NO5P |
|---|
| Molecular Mass | 245.0453 |
|---|
| SMILES | NC(Cc1ccccc1)C(=O)OP(=O)(O)O |
|---|
| InChI Key | GQWQUIOGDDFICL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acyl monophosphatesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupacyl monophosphatearomatic homomonocyclic compoundphosphoethanolamineorganic oxidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundamphetamine or derivativesacyl phosphate |
|---|