| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:05 UTC |
|---|
| Update Date | 2025-03-21 18:02:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041110 |
|---|
| Frequency | 83.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O9 |
|---|
| Molecular Mass | 262.0325 |
|---|
| SMILES | CC(=O)OC(=O)CC(CC(=O)O)(C(=O)O)C(=O)O |
|---|
| InChI Key | AHEDGNYJEJAUHN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | pentacarboxylic acids and derivatives |
|---|
| Direct Parent | pentacarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid anhydridescarboxylic acidshydrocarbon derivativesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl grouporganic oxidecarboxylic acidorganic oxygen compoundcarboxylic acid anhydridehydrocarbon derivativepentacarboxylic acid or derivativesorganooxygen compound |
|---|