| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:08 UTC |
|---|
| Update Date | 2025-03-21 18:02:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041221 |
|---|
| Frequency | 83.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H15NO2S |
|---|
| Molecular Mass | 297.0824 |
|---|
| SMILES | CS(=O)(=O)c1cccc2cccc(Nc3ccccc3)c12 |
|---|
| InChI Key | TWRUYDXFOOLAPJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundssecondary aminessulfones |
|---|
| Substituents | monocyclic benzene moietyaromatic homopolycyclic compoundsecondary amineorganosulfur compound1-naphthalene sulfonic acid or derivativesorganic oxidesulfonylorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminesulfone |
|---|
