| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:12 UTC |
|---|
| Update Date | 2025-03-21 18:02:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041375 |
|---|
| Frequency | 83.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H27NO8 |
|---|
| Molecular Mass | 445.1737 |
|---|
| SMILES | COc1ccc2c3c1OC1C(OC4OC(C(=O)O)C(O)C4O)C=CC4C(C2)N(C)CCC341 |
|---|
| InChI Key | ZYBMXSPNPMCNSI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetalsalkyl aryl ethersamino acidsanisolesazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscoumaranshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenanthrenes and derivativespiperidinessecondary alcoholstetrahydrofuranstetralinstrialkylamines |
|---|
| Substituents | tetralinphenol ethercarbonyl groupethercarboxylic acidamino acid or derivativesamino acidmonosaccharidealkyl aryl ethercarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundcoumaran1,2-diolalcoholphenanthreneazacycletetrahydrofurantertiary aliphatic aminehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
