| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:12 UTC |
|---|
| Update Date | 2025-03-21 18:02:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041379 |
|---|
| Frequency | 83.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O3 |
|---|
| Molecular Mass | 252.0786 |
|---|
| SMILES | COc1ccc(-c2cc(=O)c3ccccc3o2)cc1 |
|---|
| InChI Key | OMICQBVLCVRFGN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 4'-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisoleschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherbenzopyran1-benzopyranheteroaromatic compoundalkyl aryl ethermethoxybenzeneoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyrananisolepyranone4p-methoxyflavonoid-skeletonhydrocarbon derivativebenzenoidphenoxy compoundorganoheterocyclic compoundorganooxygen compound |
|---|