| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:12 UTC |
|---|
| Update Date | 2025-03-21 18:02:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041406 |
|---|
| Frequency | 83.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20N2O2 |
|---|
| Molecular Mass | 260.1525 |
|---|
| SMILES | CCN(CC)CCOC(=O)c1c[nH]c2ccccc12 |
|---|
| InChI Key | RUSMTRSNLRPIRK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indolecarboxylic acids and derivatives |
|---|
| Direct Parent | indolecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzenoidscarboxylic acid estersheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundspyrrole carboxylic acids and derivativestrialkylaminesvinylogous amides |
|---|
| Substituents | pyrrole-3-carboxylic acid or derivativesamino acid or derivativesindolecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtertiary amineindolecarboxylic acid derivativevinylogous amideazacycleheteroaromatic compoundtertiary aliphatic aminemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|