| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:14 UTC |
|---|
| Update Date | 2025-03-21 18:02:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041482 |
|---|
| Frequency | 87.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15N5O |
|---|
| Molecular Mass | 209.1277 |
|---|
| SMILES | CC(C)C1CNc2[nH]c(N)nc(=O)c2N1 |
|---|
| InChI Key | FAUBSDCGCDTYJS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrimidonessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | vinylogous amidepterinazacycleheteroaromatic compoundpyrimidonesecondary aminesecondary aliphatic/aromatic aminepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|