| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:51:14 UTC |
|---|
| Update Date | 2025-03-21 18:02:59 UTC |
|---|
| HMDB ID | HMDB0253873 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041484 |
|---|
| Name | L-Ascorbic acid 2-glucoside |
|---|
| Frequency | 82.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18O11 |
|---|
| Molecular Mass | 338.0849 |
|---|
| SMILES | O=C1OC(C(O)CO)C(O)=C1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | MLSJBGYKDYSOAE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides of mono- and disaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbutenolidescarbonyl compoundsdihydrofuransenoate estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholsvinylogous acids |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidecarbonyl groupmonosaccharidecarboxylic acid derivativelactonealpha,beta-unsaturated carboxylic ester2-furanonesaccharideorganic oxideacetalaliphatic heteromonocyclic compoundoxaneprimary alcoholorganoheterocyclic compounddihydrofuranenoate esteralcoholoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
