| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:16 UTC |
|---|
| Update Date | 2025-03-21 18:02:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041534 |
|---|
| Frequency | 82.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13NO |
|---|
| Molecular Mass | 235.0997 |
|---|
| SMILES | Oc1ccc(C=Cc2c[nH]c3ccccc23)cc1 |
|---|
| InChI Key | UFVXRJFPHCTFKI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | monocyclic benzene moietyazacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|