| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:51:19 UTC |
|---|
| Update Date | 2025-03-21 18:03:00 UTC |
|---|
| HMDB ID | HMDB0038551 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041668 |
|---|
| Name | Methyl 3,4,5-trimethoxycinnamate |
|---|
| Frequency | 82.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16O5 |
|---|
| Molecular Mass | 252.0998 |
|---|
| SMILES | COC(=O)C=Cc1cc(OC)c(OC)c(OC)c1 |
|---|
| InChI Key | KLXHCGFNNUQTEY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundsenoate estersfatty acid estershydrocarbon derivativesmethoxybenzenesmethyl estersmonocarboxylic acids and derivativesorganic oxidesphenoxy compounds |
|---|
| Substituents | enoate esterfatty acylphenol ethermonocyclic benzene moietycarbonyl groupetheralkyl aryl ethercarboxylic acid derivativemethoxybenzenearomatic homomonocyclic compoundalpha,beta-unsaturated carboxylic esterfatty acid estercinnamic acid or derivativesorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundanisolecarboxylic acid esterhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
