| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:20 UTC |
|---|
| Update Date | 2025-03-21 18:03:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041692 |
|---|
| Frequency | 82.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18NO5PS |
|---|
| Molecular Mass | 319.0643 |
|---|
| SMILES | CCOP(=S)(OC)Oc1ccc(CC(N)C(=O)O)cc1 |
|---|
| InChI Key | VVPXZULAPSKWRG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamphetamines and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsphenyl thiophosphatesphenylpropanoic acidsthiophosphate triesters |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidthiophosphoric acid esterorganic thiophosphoric acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesaryl thiophosphatephenyl thiophosphatearomatic homomonocyclic compoundmonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidprimary aliphatic aminethiophosphate triesterorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|