| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:26 UTC |
|---|
| Update Date | 2025-03-21 18:03:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00041963 |
|---|
| Frequency | 81.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O5 |
|---|
| Molecular Mass | 286.0841 |
|---|
| SMILES | O=C1c2c(O)cc(O)cc2CC(O)C1c1ccc(O)cc1 |
|---|
| InChI Key | DYHYDFZHGKAZQR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | phenylnaphthalenes |
|---|
| Direct Parent | phenylnaphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl alkyl ketonesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidessecondary alcoholstetralinsvinylogous acids |
|---|
| Substituents | alcoholtetralinmonocyclic benzene moietyaryl alkyl ketone1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidketonevinylogous acidorganic oxideorganic oxygen compoundphenylnaphthalenesecondary alcoholphenolhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|