| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:29 UTC |
|---|
| Update Date | 2025-03-21 18:03:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042090 |
|---|
| Frequency | 81.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12N2O4 |
|---|
| Molecular Mass | 200.0797 |
|---|
| SMILES | COC(=O)C1C(O)CC2NC(=O)NC21 |
|---|
| InChI Key | HQLCCQJWUUSQKJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscyclic alcohols and derivativeshydrocarbon derivativesimidazolidinonesmethyl estersmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | imidazolidinealcoholcarbonyl groupcarbonic acid derivativeazacyclecyclic alcoholcarboxylic acid derivativealiphatic heteropolycyclic compoundimidazolidinonebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
