| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:31 UTC |
|---|
| Update Date | 2025-03-21 18:03:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042133 |
|---|
| Frequency | 81.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O5 |
|---|
| Molecular Mass | 270.0528 |
|---|
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c(O)ccc(O)c12 |
|---|
| InChI Key | TUAPRGJSYIVNMR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 8-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoids5-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | 8-hydroxyflavonoidmonocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-2-unsubstituted benzenoidoxacyclevinylogous acidorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranone4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
