| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:51:36 UTC |
|---|
| Update Date | 2025-03-21 18:03:07 UTC |
|---|
| HMDB ID | HMDB0242185 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042332 |
|---|
| Name | N-Oleoyl-L-Serine |
|---|
| Frequency | 80.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H39NO4 |
|---|
| Molecular Mass | 369.2879 |
|---|
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CO)C(=O)O |
|---|
| InChI Key | MBDKGXAMSZIDKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-acyl-alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholssecondary carboxylic acid amidesserine and derivatives |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidfatty amidebeta-hydroxy acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholalcoholn-acyl-alpha-amino acidhydroxy acidcarboxamide groupn-acyl-aminesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundserine or derivativesorganooxygen compound |
|---|
