Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:51:36 UTC |
---|
Update Date | 2025-03-21 18:03:08 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00042341 |
---|
Frequency | 100.7 |
---|
Structure | |
---|
Chemical Formula | C10H16N2O3S2 |
---|
Molecular Mass | 276.0602 |
---|
SMILES | C=CCNC(=S)SCC(NC(=O)CC)C(=O)O |
---|
InChI Key | UHWQWAMFUBAWAH-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | n-acyl-alpha amino acids |
---|
Geometric Descriptor | aliphatic acyclic compounds |
---|
Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdithiocarbamic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfenyl compounds |
---|
Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidsulfenyl compoundn-acyl-alpha-amino acidorganosulfur compoundcarboxamide groupsecondary carboxylic acid amidedithiocarbamic acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcysteine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|