| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:37 UTC |
|---|
| Update Date | 2025-03-21 18:03:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042414 |
|---|
| Frequency | 80.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12ClN5O4 |
|---|
| Molecular Mass | 301.0578 |
|---|
| SMILES | Nc1nc2c(ncn2C2OC(CCl)C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | YBIZLKQGKRXLAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | 5'-deoxyribonucleosides |
|---|
| Subclass | 5'-deoxyribonucleosides |
|---|
| Direct Parent | 5'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl chloridesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganochloridesorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactamalkyl chlorideorganochloridemonosaccharidepyrimidoneimidazopyrimidineorganohalogen compoundpyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundalkyl halideorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholvinylogous amide5'-deoxyribonucleosideazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|