| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:38 UTC |
|---|
| Update Date | 2025-03-21 18:03:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042435 |
|---|
| Frequency | 80.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9ClN2O3S |
|---|
| Molecular Mass | 248.0022 |
|---|
| SMILES | CC(=O)Nc1ccc(S(N)(=O)=O)c(Cl)c1 |
|---|
| InChI Key | ICCMUORQFMPCBH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | m-haloacetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesaminosulfonyl compoundsaryl chloridesbenzenesulfonamidesbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganochloridesorganopnictogen compoundsorganosulfonamidessecondary carboxylic acid amides |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupn-acetylarylamineorganochloriden-arylamideorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidebenzenesulfonyl grouparyl chloridechlorobenzenebenzenesulfonamideaminosulfonyl compoundcarboxamide grouparyl halidearomatic homomonocyclic compoundsecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundhalobenzenem-haloacetanilideorganooxygen compound |
|---|