| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:38 UTC |
|---|
| Update Date | 2025-03-21 18:03:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042452 |
|---|
| Frequency | 80.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11NO9S |
|---|
| Molecular Mass | 273.0155 |
|---|
| SMILES | O=C(O)C1OC(O)C(NS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | RCDIXZUAEPPVDG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssulfuric acid monoamides |
|---|
| Substituents | carbonyl groupcarboxylic acidmonosaccharidepyran carboxylic acidbeta-hydroxy acidsaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaldelta amino acid or derivativesoxaneorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativesorganic sulfuric acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransulfuric acid monoamidesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|