| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:42 UTC |
|---|
| Update Date | 2025-03-21 18:03:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042600 |
|---|
| Frequency | 110.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N6O |
|---|
| Molecular Mass | 206.0916 |
|---|
| SMILES | NCCc1c[nH]c2nc(N)nc(=O)c-2n1 |
|---|
| InChI Key | JTADCIHSLNDVEY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmonoalkylaminesorganic oxidesorganooxygen compoundsorganopnictogen compoundspyrazinespyrimidones |
|---|
| Substituents | pterinazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
