| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:45 UTC |
|---|
| Update Date | 2025-03-21 18:03:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042718 |
|---|
| Frequency | 79.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O |
|---|
| Molecular Mass | 190.1358 |
|---|
| SMILES | C=C(C)C(=O)C1=C(C)C=CCC1(C)C |
|---|
| InChI Key | ROTKNXZHHXFMHT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alpha-branched alpha,beta-unsaturated ketones |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesketonesorganic oxides |
|---|
| Substituents | ketonealpha-branched alpha,beta-unsaturated-ketoneorganic oxidealiphatic homomonocyclic compoundhydrocarbon derivative |
|---|