| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:51 UTC |
|---|
| Update Date | 2025-03-21 18:03:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042964 |
|---|
| Frequency | 79.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7NO5S |
|---|
| Molecular Mass | 217.0045 |
|---|
| SMILES | NS(=O)(=O)Oc1ccc(C(=O)O)cc1 |
|---|
| InChI Key | ZNXYYBKXMQZZPG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganic sulfuric acids and derivativesorganooxygen compoundsphenoxy compounds |
|---|
| Substituents | carboxylic acidorganic sulfuric acid or derivativesbenzoylcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundbenzoic acidphenoxy compoundorganooxygen compound |
|---|
