| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:52 UTC |
|---|
| Update Date | 2025-03-21 18:03:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00042996 |
|---|
| Frequency | 79.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N5O7P |
|---|
| Molecular Mass | 333.0474 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(O)(COP(=O)(O)O)C1O |
|---|
| InChI Key | BEEZQTRAHVXUOY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundshemiacetalsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxetanesprimary aminespyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | pyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhemiacetalimidolactamazolen-substituted imidazolealcoholazacycleheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphateoxetanesecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
