| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:53 UTC |
|---|
| Update Date | 2025-03-21 18:03:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043042 |
|---|
| Frequency | 79.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H8O5 |
|---|
| Molecular Mass | 268.0372 |
|---|
| SMILES | O=c1oc2c3ccc(O)cc3oc2c2cc(O)ccc12 |
|---|
| InChI Key | RMEHVOVPXZLFKY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isocoumarins and derivatives |
|---|
| Subclass | isocoumarins and derivatives |
|---|
| Direct Parent | isocoumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-benzopyransbenzenoidsbenzofuransfuransheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | furanbenzopyranbenzofuranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidisocoumarinlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyran2-benzopyranpyranonehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
