| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:55 UTC |
|---|
| Update Date | 2025-03-21 18:03:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043138 |
|---|
| Frequency | 128.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15NO6 |
|---|
| Molecular Mass | 245.0899 |
|---|
| SMILES | O=C(O)CN=C(O)CC1CCC(CC(=O)O)O1 |
|---|
| InChI Key | HLQKSFHDBWQABS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboximidic acidscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspropargyl-type 1,3-dipolar organic compoundstetrahydrofurans |
|---|
| Substituents | carboximidic acidcarbonyl groupethercarboxylic acidtetrahydrofuranorganic 1,3-dipolar compounddialkyl etherpropargyl-type 1,3-dipolar organic compoundoxacycleorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|