| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:55 UTC |
|---|
| Update Date | 2025-03-21 18:03:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043153 |
|---|
| Frequency | 78.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H6Cl10 |
|---|
| Molecular Mass | 475.7355 |
|---|
| SMILES | ClC1C(Cl)C2C(C1Cl)C1(Cl)C(Cl)(Cl)C(Cl)C2(Cl)C1(Cl)Cl |
|---|
| InChI Key | VBWBXBPLCZDNHF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | monoterpenoids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl chlorideshydrocarbon derivativesorganochlorides |
|---|
| Substituents | monoterpenoidalkyl chlorideorganochloridenorbornane monoterpenoidalkyl halidehydrocarbon derivativeorganohalogen compoundaliphatic homopolycyclic compound |
|---|