| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:51:57 UTC |
|---|
| Update Date | 2025-03-21 18:03:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043236 |
|---|
| Frequency | 78.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H42O20 |
|---|
| Molecular Mass | 650.2269 |
|---|
| SMILES | CC1OC(OCC2OC(OCC3OC(OC4C(CO)OC(O)C(O)C4O)C(O)C(O)C3O)C(O)C(O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | OUEGNZJLVXWADH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalshemiacetalshydrocarbon derivativesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmonosaccharideoxacycleacetalaliphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compound |
|---|