| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:51:59 UTC |
|---|
| Update Date | 2025-03-21 18:03:17 UTC |
|---|
| HMDB ID | HMDB0029219 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043287 |
|---|
| Name | Urolithin D |
|---|
| Frequency | 78.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H8O6 |
|---|
| Molecular Mass | 260.0321 |
|---|
| SMILES | O=c1oc2c(O)c(O)ccc2c2cc(O)c(O)cc12 |
|---|
| InChI Key | NEZDQSKPNPRYAW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-benzopyransbenzenoidsheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | benzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidisocoumarincoumarinlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyran2-benzopyranpyranonehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
