| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:00 UTC |
|---|
| Update Date | 2025-03-21 18:03:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043332 |
|---|
| Frequency | 78.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9NO7S |
|---|
| Molecular Mass | 275.01 |
|---|
| SMILES | O=C1C(OS(=O)(=O)O)COc2ccccc2N1O |
|---|
| InChI Key | GPHLAEVTLHQQJY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxazepines |
|---|
| Subclass | 1,4-oxazepines |
|---|
| Direct Parent | 1,4-oxazepines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalkyl sulfatesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeshydroxamic acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupetherorganic sulfuric acid or derivativesazacyclealkyl aryl ethercarboxylic acid derivativepara-oxazepineoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundalkyl sulfateorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundhydroxamic acidsulfuric acid esterorganooxygen compound |
|---|