| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:01 UTC |
|---|
| Update Date | 2025-03-21 18:03:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043376 |
|---|
| Frequency | 78.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H33ClN10 |
|---|
| Molecular Mass | 484.2578 |
|---|
| SMILES | Cc1ccccc1NC(=N)NC(=N)NCCCCCCNC(=N)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | VLTLZSPSFMPRFQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | guanidines |
|---|
| Direct Parent | 1-arylbiguanides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarboximidamideschlorobenzeneshydrocarbon derivativesiminesorganochloridesorganopnictogen compoundstoluenes |
|---|
| Substituents | aryl chloridechlorobenzenemonocyclic benzene moietyimineorganochloridecarboximidamideorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivative1-arylbiguanidebenzenoidhalobenzenetoluene |
|---|