| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:05 UTC |
|---|
| Update Date | 2025-03-21 18:03:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043561 |
|---|
| Frequency | 78.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19NO8 |
|---|
| Molecular Mass | 281.1111 |
|---|
| SMILES | COC1(C(=O)O)CC(O)C(N)C(C(O)C(O)CO)O1 |
|---|
| InChI Key | OMVQZDUAKZZNEF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdelta amino acids and derivativeshydrocarbon derivativesketalsmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidcarboxylic acid derivativepyran carboxylic acidorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddelta amino acid or derivativesoxaneprimary alcoholorganoheterocyclic compoundc-glucuronidealcoholpyran carboxylic acid or derivativesoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound |
|---|
