| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:52:07 UTC | 
|---|
| Update Date | 2025-03-21 18:03:21 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00043645 | 
|---|
| Frequency | 77.8 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C7H10O7 | 
|---|
| Molecular Mass | 206.0427 | 
|---|
| SMILES | O=C(O)CC1OC(=O)C(O)C(O)C1O | 
|---|
| InChI Key | FZCZAFVWAXBATN-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic oxygen compounds | 
|---|
| Class | organooxygen compounds | 
|---|
| Subclass | carbohydrates and carbohydrate conjugates | 
|---|
| Direct Parent | gluconolactones | 
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds | 
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid esterscarboxylic acidsdelta valerolactonesdicarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols | 
|---|
| Substituents | alcoholcarbonyl groupcarboxylic aciddelta valerolactonecarboxylic acid derivativelactoneoxacycleorganic oxidegluconolactonecarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeoxanedelta_valerolactoneorganoheterocyclic compound | 
|---|