| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:08 UTC |
|---|
| Update Date | 2025-03-21 18:03:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043651 |
|---|
| Frequency | 77.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16O3 |
|---|
| Molecular Mass | 244.1099 |
|---|
| SMILES | OCC(Cc1ccc(O)cc1)c1ccc(O)cc1 |
|---|
| InChI Key | WPRITGBJGHUHOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesprimary alcohols |
|---|
| Substituents | alcoholaromatic homomonocyclic compoundmonocyclic benzene moietyorganic oxygen compound1-hydroxy-2-unsubstituted benzenoidphenolhydrocarbon derivativebenzenoidprimary alcoholorganooxygen compoundstilbene |
|---|
