| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:09 UTC |
|---|
| Update Date | 2025-03-21 18:03:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043710 |
|---|
| Frequency | 77.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N3O2S2 |
|---|
| Molecular Mass | 273.0606 |
|---|
| SMILES | NC(CCSCc1ccccc1)=NS(N)(=O)=O |
|---|
| InChI Key | KUKVPHYWVGRITP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amidinesdialkylthioethershydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundssulfenyl compounds |
|---|
| Substituents | monocyclic benzene moietyorganic sulfuric acid or derivativessulfenyl compounddialkylthioetheramidineorganosulfur compoundaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
