| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:10 UTC |
|---|
| Update Date | 2025-03-21 18:03:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043756 |
|---|
| Frequency | 84.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11N5O3 |
|---|
| Molecular Mass | 225.0862 |
|---|
| SMILES | Nc1nc2c(ncn2CC(O)CO)c(=O)[nH]1 |
|---|
| InChI Key | UHZYGPBCTIWWBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholazole1,2-dioln-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|