| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:12 UTC |
|---|
| Update Date | 2025-03-21 18:03:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043828 |
|---|
| Frequency | 77.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H24BrNO |
|---|
| Molecular Mass | 325.1041 |
|---|
| SMILES | CN(C)CC(c1ccc(Br)cc1)C1(O)CCCCC1 |
|---|
| InChI Key | JTDRMEWIAHOIGB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | bromobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcoholsaryl bromidescyclic alcohols and derivativescyclohexanolshydrocarbon derivativesorganobromidesorganopnictogen compoundstertiary alcoholstrialkylamines |
|---|
| Substituents | alcohol1,3-aminoalcoholtertiary aliphatic aminecyclohexanolbromobenzenecyclic alcoholorganohalogen compoundaryl halidearomatic homomonocyclic compoundtertiary alcoholorganic oxygen compoundorganonitrogen compoundorganobromideorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaryl bromideaminetertiary amineorganooxygen compound |
|---|
