| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:13 UTC |
|---|
| Update Date | 2025-03-21 18:03:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00043880 |
|---|
| Frequency | 77.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O3 |
|---|
| Molecular Mass | 256.1099 |
|---|
| SMILES | O=C(O)CCC(O)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | LYKBSKKCKKVMPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | aromatic alcoholalcoholdiphenylmethanecarbonyl groupcarboxylic acidcarboxylic acid derivativearomatic homomonocyclic compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|