| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:18 UTC |
|---|
| Update Date | 2025-03-21 18:03:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044058 |
|---|
| Frequency | 76.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14O7 |
|---|
| Molecular Mass | 258.074 |
|---|
| SMILES | OCC1OC(c2cc(O)c(O)c(O)c2)C(O)C1O |
|---|
| InChI Key | IUCBZKDIJFCYPB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethershydrocarbon derivativesmonosaccharidesoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholmonocyclic benzene moietyetherpyrogallol derivativearomatic heteromonocyclic compoundtetrahydrofuran1-hydroxy-2-unsubstituted benzenoidmonosaccharide1-hydroxy-4-unsubstituted benzenoiddialkyl etheroxacyclesaccharideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
