| Record Information | 
|---|
| HMDB Status | expected | 
|---|
| Creation Date | 2024-02-20 23:52:18 UTC | 
|---|
| Update Date | 2025-03-21 18:03:24 UTC | 
|---|
| HMDB ID | HMDB0041024 | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00044086 | 
|---|
| Name | Hydroxytyrosol 1-O-glucoside | 
|---|
| Frequency | 76.8 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C14H20O8 | 
|---|
| Molecular Mass | 316.1158 | 
|---|
| SMILES | OCC1OC(OCCc2ccc(O)c(O)c2)C(O)C(O)C1O | 
|---|
| InChI Key | PQQITYGQJLPDFC-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | benzenoids | 
|---|
| Class | phenols | 
|---|
| Subclass | tyrosols and derivatives | 
|---|
| Direct Parent | tyrosols and derivatives | 
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds | 
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativeshydrocarbon derivativesmonosaccharidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols | 
|---|
| Substituents | alcoholmonocyclic benzene moietyaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharide1-hydroxy-4-unsubstituted benzenoidoxacyclesaccharideorganic oxygen compoundacetalsecondary alcoholhydrocarbon derivativetyrosol derivativeoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound | 
|---|