| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:52:19 UTC | 
|---|
| Update Date | 2025-03-21 18:03:24 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00044103 | 
|---|
| Frequency | 76.8 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C16H16O4 | 
|---|
| Molecular Mass | 272.1049 | 
|---|
| SMILES | CC1Cc2c(O)cc(O)cc2OC1c1ccc(O)cc1 | 
|---|
| InChI Key | QUNOXWLVKXQUDE-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | phenylpropanoids and polyketides | 
|---|
| Class | flavonoids | 
|---|
| Subclass | hydroxyflavonoids | 
|---|
| Direct Parent | 5-hydroxyflavonoids | 
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds | 
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativesflavanshydrocarbon derivativesoxacyclic compounds | 
|---|
| Substituents | monocyclic benzene moietyetherbenzopyran1-benzopyranflavan5-hydroxyflavonoid1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compound7-hydroxyflavonoidchromane4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound | 
|---|