| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-20 23:52:19 UTC | 
|---|
| Update Date | 2025-03-21 18:03:25 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID00044122 | 
|---|
| Frequency | 76.8 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C17H16O4 | 
|---|
| Molecular Mass | 284.1049 | 
|---|
| SMILES | O=C1OC(Cc2cccc(O)c2)C1Cc1cccc(O)c1 | 
|---|
| InChI Key | YFEAVAGSMRHXIP-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | benzenoids | 
|---|
| Class | phenols | 
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids | 
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids | 
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds | 
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesbeta propiolactonescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxetanes | 
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativebeta_propiolactonelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteroxetanehydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound | 
|---|