| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:23 UTC |
|---|
| Update Date | 2025-03-21 18:03:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044266 |
|---|
| Frequency | 76.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12O4 |
|---|
| Molecular Mass | 232.0736 |
|---|
| SMILES | COc1ccc2ccc(C(O)C(=O)O)cc2c1 |
|---|
| InChI Key | BAAAJAKGQPBAAQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenes |
|---|
| Direct Parent | naphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha hydroxy acids and derivativesanisolesaromatic alcoholscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholphenol ethercarbonyl groupethercarboxylic acidalpha-hydroxy acidaromatic homopolycyclic compoundhydroxy acidalkyl aryl ethercarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|