| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:24 UTC |
|---|
| Update Date | 2025-03-21 18:03:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044320 |
|---|
| Frequency | 76.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H27NO9 |
|---|
| Molecular Mass | 461.1686 |
|---|
| SMILES | COc1ccc2c3c1OC1C(OC4OC(C(=O)O)C(O)C(O)C4O)C=CC4C2N(C)CCC341 |
|---|
| InChI Key | SHIVUOCASAUIKC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersamino acidsanisolesaralkylaminesazacyclic compoundsazepinesbenzazepinesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscoumaransfluorenesglucuronic acid derivativeshydrocarbon derivativesindanesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespiperidinespyran carboxylic acidssecondary alcoholstrialkylamines |
|---|
| Substituents | fluorenephenol ethercarbonyl groupethercarboxylic acidamino acid or derivativesamino acido-glucuronidemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acidaralkylamine1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxanepiperidinetertiary amineorganoheterocyclic compoundcoumaranalcoholpyran carboxylic acid or derivativesazacycletertiary aliphatic aminehydroxy acidoxacyclemonocarboxylic acid or derivativesazepinepyrananisoleindanesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundbenzazepineamine |
|---|
