| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:52:30 UTC |
|---|
| Update Date | 2025-03-21 18:03:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00044559 |
|---|
| Frequency | 75.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10N8 |
|---|
| Molecular Mass | 254.1028 |
|---|
| SMILES | Nc1nc(N)c2nc(-c3ccccn3)c(N)nc2n1 |
|---|
| InChI Key | LMQDQSRSPMRONG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrazinespyridines and derivativespyrimidines and pyrimidine derivatives |
|---|
| Substituents | azacycleheteroaromatic compoundpteridinepyrimidinepyridinearomatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amine2-halopyridineorganic nitrogen compoundimidolactamamine |
|---|
